CAS 15018-62-9 appears in our catalog under these names: 5-Bromoorotic acid, 95%, 5-Bromoorotic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 1000mg, 2000mg, 5000mg.
5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 15018-62-9) is a chemical compound with the molecular formula C5H3BrN2O4 and a molecular weight of 234.99 g/mol. IUPAC name: 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: YQYHIPBLZSIHDI-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O4 |
|---|---|
| Molecular weight | 234.99 g/mol |
| IUPAC name | 5-bromo-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | YQYHIPBLZSIHDI-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)Br |
Computed by PubChem (NCBI)