CAS 408328-18-7 is the registry number for 5-Bromo-4-hydroxy-3-nitropyridin-2(1H)-one, 95%. Offered by: AmBeed. Available pack sizes: 10g.
5-bromo-4-hydroxy-3-nitro-1H-pyridin-2-one (CAS 408328-18-7) is a chemical compound with the molecular formula C5H3BrN2O4 and a molecular weight of 234.99 g/mol. IUPAC name: 5-bromo-4-hydroxy-3-nitro-1H-pyridin-2-one. InChIKey: PUAJVHSNEHQMNU-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O4 |
|---|---|
| Molecular weight | 234.99 g/mol |
| IUPAC name | 5-bromo-4-hydroxy-3-nitro-1H-pyridin-2-one |
| InChIKey | PUAJVHSNEHQMNU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=O)N1)[N+](=O)[O-])O)Br |
Computed by PubChem (NCBI)