Products 1501832-57-0
CAS 1501832-57-0 is the registry number for 7-Bromo-1H,2H,3H,3aH,4H,5H-pyrrolo(1,2-a)quinoxalin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-bromo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one (CAS 1501832-57-0) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: 7-bromo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one. InChIKey: QGRSOFAQUPTDGO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 7-bromo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one |
| InChIKey | QGRSOFAQUPTDGO-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)NC3=C(N2C1)C=CC(=C3)Br |
Computed by PubChem (NCBI)