CAS 1501926-22-2 is the registry number for 1-(4-Methylphenyl)-5-(propan-2-yl)-1H-pyrazol-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-methylphenyl)-5-propan-2-ylpyrazol-4-amine (CAS 1501926-22-2) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: 1-(4-methylphenyl)-5-propan-2-ylpyrazol-4-amine. InChIKey: WQHWRPZHOXYLIP-UHFFFAOYSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 1-(4-methylphenyl)-5-propan-2-ylpyrazol-4-amine |
| InChIKey | WQHWRPZHOXYLIP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C=N2)N)C(C)C |
Computed by PubChem (NCBI)