CAS 150205-21-3 appears in our catalog under these names: 1,2,3,7,8-Pentachloronaphthalene, >95% (HPLC), 1,2,3,7,8-PentachloronaphthaleneContains H290945, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
1,2,3,7,8-pentachloronaphthalene (CAS 150205-21-3) is a chemical compound with the molecular formula C10H3Cl5 and a molecular weight of 300.4 g/mol. IUPAC name: 1,2,3,7,8-pentachloronaphthalene. InChIKey: BFRRJXVSQTZQHM-UHFFFAOYSA-N.
| Molecular formula | C10H3Cl5 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 1,2,3,7,8-pentachloronaphthalene |
| InChIKey | BFRRJXVSQTZQHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C(C(=C(C=C21)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)