CAS 150224-17-2 is the registry number for 1,2,4,6,7-Pentachloronaphthalene. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,4,6,7-pentachloronaphthalene (CAS 150224-17-2) is a chemical compound with the molecular formula C10H3Cl5 and a molecular weight of 300.4 g/mol. IUPAC name: 1,2,4,6,7-pentachloronaphthalene. InChIKey: GXQUDLBNLKOIQB-UHFFFAOYSA-N.
| Molecular formula | C10H3Cl5 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 1,2,4,6,7-pentachloronaphthalene |
| InChIKey | GXQUDLBNLKOIQB-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)C(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)