CAS 150214-93-0 appears in our catalog under these names: trans-Haloperidol N-Oxide, trans-Haloperidol N-Oxide, >95% (HPLC), trans-Haloperidol impurity 7. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 25mg, 100mg, Get quote.
4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one (CAS 150214-93-0) is a chemical compound with the molecular formula C21H23ClFNO3 and a molecular weight of 391.9 g/mol. IUPAC name: 4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one. InChIKey: LDKZFGVWYVWUSG-UHFFFAOYSA-N.
| Molecular formula | C21H23ClFNO3 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | 4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one |
| InChIKey | LDKZFGVWYVWUSG-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC1(C2=CC=C(C=C2)Cl)O)(CCCC(=O)C3=CC=C(C=C3)F)[O-] |
Computed by PubChem (NCBI)