CAS 150214-94-1 is the registry number for cis-Haloperidol N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 2,5mg.
4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one (CAS 150214-94-1) is a chemical compound with the molecular formula C21H23ClFNO3 and a molecular weight of 391.9 g/mol. IUPAC name: 4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one. InChIKey: LDKZFGVWYVWUSG-UHFFFAOYSA-N.
| Molecular formula | C21H23ClFNO3 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | 4-[4-(4-chlorophenyl)-4-hydroxy-1-oxidopiperidin-1-ium-1-yl]-1-(4-fluorophenyl)butan-1-one |
| InChIKey | LDKZFGVWYVWUSG-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCC1(C2=CC=C(C=C2)Cl)O)(CCCC(=O)C3=CC=C(C=C3)F)[O-] |
Computed by PubChem (NCBI)