Products 1502265-53-3

CAS 1502265-53-3 is the registry number for 2-(3-Bromo-5-chlorophenoxy)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(3-bromo-5-chlorophenoxy)acetic acid (CAS 1502265-53-3) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: 2-(3-bromo-5-chlorophenoxy)acetic acid. InChIKey: MULBKZQWGOCJDO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO3
Molecular weight265.49 g/mol
IUPAC name2-(3-bromo-5-chlorophenoxy)acetic acid
InChIKeyMULBKZQWGOCJDO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Br)OCC(=O)O

Computed by PubChem (NCBI)