CAS 150251-25-5 is the registry number for 2-(3,5-Dimethylphenyl)-2-oxoacetaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3,5-dimethylphenyl)-2-oxoacetaldehyde (CAS 150251-25-5) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-2-oxoacetaldehyde. InChIKey: COKLAMNWIKZGIN-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-2-oxoacetaldehyde |
| InChIKey | COKLAMNWIKZGIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C=O)C |
Computed by PubChem (NCBI)