Products 150259-29-3
CAS 150259-29-3 appears in our catalog under these names: 3-(2-Bromoethyl)-1,3-diazaspiro(4.4)nonane-2,4-dione, 3-(2-Bromoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione, 95%, 95%, 3-(2-Bromoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
3-(2-bromoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (CAS 150259-29-3) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: 3-(2-bromoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione. InChIKey: YMGZPVIVRDIJAI-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 3-(2-bromoethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| InChIKey | YMGZPVIVRDIJAI-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)N2)CCBr |
Computed by PubChem (NCBI)