Products 15026-80-9

CAS 15026-80-9 is the registry number for Irbesartan Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(pentanoylamino)cyclopentane-1-carboxylic acid (CAS 15026-80-9) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: 1-(pentanoylamino)cyclopentane-1-carboxylic acid. InChIKey: HPHUHSPLHSCYJB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO3
Molecular weight213.27 g/mol
IUPAC name1-(pentanoylamino)cyclopentane-1-carboxylic acid
InChIKeyHPHUHSPLHSCYJB-UHFFFAOYSA-N
SMILESCCCCC(=O)NC1(CCCC1)C(=O)O

Computed by PubChem (NCBI)