CAS 1503028-93-0 is the registry number for 3-(3,5-Bis(trifluoromethyl)phenyl)cyclobutan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3,5-bis(trifluoromethyl)phenyl]cyclobutan-1-ol (CAS 1503028-93-0) is a chemical compound with the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]cyclobutan-1-ol. InChIKey: QGAVJTAIYMQOFG-UHFFFAOYSA-N.
| Molecular formula | C12H10F6O |
|---|---|
| Molecular weight | 284.20 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]cyclobutan-1-ol |
| InChIKey | QGAVJTAIYMQOFG-UHFFFAOYSA-N |
| SMILES | C1C(CC1O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)