Products 2969616-95-1
CAS 2969616-95-1 is the registry number for (E)-1-(3,5-bis(trifluoromethyl)phenyl)but-2-en-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-1-[3,5-bis(trifluoromethyl)phenyl]but-2-en-1-ol (CAS 2969616-95-1) is a chemical compound with the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. IUPAC name: (E)-1-[3,5-bis(trifluoromethyl)phenyl]but-2-en-1-ol. InChIKey: ZTUQCMWKIFHUJB-NSCUHMNNSA-N.
| Molecular formula | C12H10F6O |
|---|---|
| Molecular weight | 284.20 g/mol |
| IUPAC name | (E)-1-[3,5-bis(trifluoromethyl)phenyl]but-2-en-1-ol |
| InChIKey | ZTUQCMWKIFHUJB-NSCUHMNNSA-N |
| SMILES | C/C=C/C(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)