Products 1503192-72-0
CAS 1503192-72-0 is the registry number for 3-(7-Bromo-3,4-dihydroquinoxalin-1(2H)-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide (CAS 1503192-72-0) is a chemical compound with the molecular formula C12H15BrN2O2S and a molecular weight of 331.23 g/mol. IUPAC name: 3-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide. InChIKey: YQKLEAAIKNFEFL-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2S |
|---|---|
| Molecular weight | 331.23 g/mol |
| IUPAC name | 3-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide |
| InChIKey | YQKLEAAIKNFEFL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)