CAS 2243657-77-2 is the registry number for 4-(6-Bromoindolin-3-yl)thiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide (CAS 2243657-77-2) is a chemical compound with the molecular formula C12H15BrN2O2S and a molecular weight of 331.23 g/mol. IUPAC name: 4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide. InChIKey: IUFJNBHGUYAXPS-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2S |
|---|---|
| Molecular weight | 331.23 g/mol |
| IUPAC name | 4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide |
| InChIKey | IUFJNBHGUYAXPS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2CNC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)