Products 2243657-77-2

CAS 2243657-77-2 is the registry number for 4-(6-Bromoindolin-3-yl)thiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide (CAS 2243657-77-2) is a chemical compound with the molecular formula C12H15BrN2O2S and a molecular weight of 331.23 g/mol. IUPAC name: 4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide. InChIKey: IUFJNBHGUYAXPS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrN2O2S
Molecular weight331.23 g/mol
IUPAC name4-(6-bromo-2,3-dihydro-1H-indol-3-yl)-1,4-thiazinane 1,1-dioxide
InChIKeyIUFJNBHGUYAXPS-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1C2CNC3=C2C=CC(=C3)Br

Computed by PubChem (NCBI)