CAS 1503194-62-4 is the registry number for 1-(2,2,2-Trifluoroethyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione (CAS 1503194-62-4) is a chemical compound with the molecular formula C6H7F3N2O2 and a molecular weight of 196.13 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione. InChIKey: XEILHGMINQBMQP-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N2O2 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione |
| InChIKey | XEILHGMINQBMQP-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)CC(F)(F)F |
Computed by PubChem (NCBI)