CAS 23809-63-4 is the registry number for 5-(3,3,3-Trifluoropropyl)imidazolidine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,3,3-trifluoropropyl)imidazolidine-2,4-dione (CAS 23809-63-4) is a chemical compound with the molecular formula C6H7F3N2O2 and a molecular weight of 196.13 g/mol. IUPAC name: 5-(3,3,3-trifluoropropyl)imidazolidine-2,4-dione. InChIKey: SXHNKTVRBDLLOL-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N2O2 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 5-(3,3,3-trifluoropropyl)imidazolidine-2,4-dione |
| InChIKey | SXHNKTVRBDLLOL-UHFFFAOYSA-N |
| SMILES | C(CC(F)(F)F)C1C(=O)NC(=O)N1 |
Computed by PubChem (NCBI)