Products 1503801-78-2
CAS 1503801-78-2 appears in our catalog under these names: 3,5-Dimethyl-1-(4-(trifluoromethyl)phenyl)piperazine, 95%, 3,5-Dimethyl-1-(4-(trifluoromethyl)phenyl)piperazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine (CAS 1503801-78-2) is a chemical compound with the molecular formula C13H17F3N2 and a molecular weight of 258.28 g/mol. IUPAC name: 3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine. InChIKey: SGWRYODCWZLVHM-UHFFFAOYSA-N.
| Molecular formula | C13H17F3N2 |
|---|---|
| Molecular weight | 258.28 g/mol |
| IUPAC name | 3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine |
| InChIKey | SGWRYODCWZLVHM-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(N1)C)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)