CAS 445465-72-5 is the registry number for 2-(4-Methylpiperidin-1-yl)-5-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)aniline (CAS 445465-72-5) is a chemical compound with the molecular formula C13H17F3N2 and a molecular weight of 258.28 g/mol. IUPAC name: 2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)aniline. InChIKey: KSTMIUZGZUTXPS-UHFFFAOYSA-N.
| Molecular formula | C13H17F3N2 |
|---|---|
| Molecular weight | 258.28 g/mol |
| IUPAC name | 2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | KSTMIUZGZUTXPS-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)