CAS 150438-78-1 appears in our catalog under these names: N–Boc–O–allyl–L–serine, (S)-3-(Allyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid, 97%, 97%, N-Boc-O-allyl-L-serine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoic acid (CAS 150438-78-1) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoic acid. InChIKey: AJBUKLQZLAOFEA-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoic acid |
| InChIKey | AJBUKLQZLAOFEA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCC=C)C(=O)O |
Computed by PubChem (NCBI)