CAS 1505456-00-7 appears in our catalog under these names: 10,10'-Bis(3,5-bis(trifluoromethyl)phenyl)-9,9'-bianthracene, 99%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(1,4-phenylene))end capped with dimethylphenyl. Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
2-(3-chloroanilino)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 1505456-00-7) is a chemical compound with the molecular formula C12H10ClN5O and a molecular weight of 275.69 g/mol. IUPAC name: 2-(3-chloroanilino)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: SYMDGGIVYBXXCR-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN5O |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | 2-(3-chloroanilino)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | SYMDGGIVYBXXCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)