CAS 1627180-59-9 is the registry number for 5-Chloro-3-(4-ethoxyphenyl)-3H-(1,2,3)triazolo(4,5-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidine (CAS 1627180-59-9) is a chemical compound with the molecular formula C12H10ClN5O and a molecular weight of 275.69 g/mol. IUPAC name: 5-chloro-3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidine. InChIKey: PEXXCTFDZVJAAY-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN5O |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | 5-chloro-3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidine |
| InChIKey | PEXXCTFDZVJAAY-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C3=NC(=NC=C3N=N2)Cl |
Computed by PubChem (NCBI)