CAS 15058-19-2 appears in our catalog under these names: 2–Methyl–2–thiazoline–4–carboxylic Acid (sodium salt), 2-Methyl-2-thiazoline-4-carboxylic acid (sodium), 99.77%, 2-Methyl-2-thiazoline-4-carboxylic acid sodium salt, SODIUM 2-METHYL-4,5-DIHYDRO-1,3-THIAZOL&, Sodium 2-methyl-4,5-dihydrothiazole-4-carboxylate 97%. Offered by: GLPBio, MedChemExpress, HPC Standards, Sigma-Aldrich, Ambeed. Available pack sizes: 100g, 250g, 50g, 500 mg, 100 mg, 25 mg, 50 mg, 1 g.
Sodium 2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 15058-19-2) is a chemical compound with the molecular formula C5H6NNaO2S and a molecular weight of 167.16 g/mol. IUPAC name: sodium 2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: KDIYEJLRFZLXKU-UHFFFAOYSA-M.
| Molecular formula | C5H6NNaO2S |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | sodium 2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | KDIYEJLRFZLXKU-UHFFFAOYSA-M |
| SMILES | CC1=NC(CS1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)