CAS 304675-78-3 is the registry number for 2-Mercaptopyridine n-oxide sodium salt hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 500g, 25g, 1kg, 100g, 5g.
Sodium;1-oxidopyridine-2-thione;hydrate (CAS 304675-78-3) is a chemical compound with the molecular formula C5H6NNaO2S and a molecular weight of 167.16 g/mol. IUPAC name: sodium;1-oxidopyridine-2-thione;hydrate. InChIKey: CMXTXFRFROPVGZ-UHFFFAOYSA-N.
| Molecular formula | C5H6NNaO2S |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | sodium;1-oxidopyridine-2-thione;hydrate |
| InChIKey | CMXTXFRFROPVGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)N(C=C1)[O-].O.[Na+] |
Computed by PubChem (NCBI)