CAS 1506350-69-1 appears in our catalog under these names: 2-((5-Amino-1H-1,3-benzodiazol-2-yl)(methyl)amino)-N-methylacetamide, 95%, 2-((5-Amino-1H-1,3-benzodiazol-2-yl)(methyl)amino)-N-methylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[(6-amino-1H-benzimidazol-2-yl)-methylamino]-N-methylacetamide (CAS 1506350-69-1) is a chemical compound with the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. IUPAC name: 2-[(6-amino-1H-benzimidazol-2-yl)-methylamino]-N-methylacetamide. InChIKey: YREYLLLQLLXVKS-UHFFFAOYSA-N.
| Molecular formula | C11H15N5O |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 2-[(6-amino-1H-benzimidazol-2-yl)-methylamino]-N-methylacetamide |
| InChIKey | YREYLLLQLLXVKS-UHFFFAOYSA-N |
| SMILES | CNC(=O)CN(C)C1=NC2=C(N1)C=C(C=C2)N |
Computed by PubChem (NCBI)