Products 1506559-89-2
CAS 1506559-89-2 is the registry number for 4-Methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg.
4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1506559-89-2) is a chemical compound with the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. IUPAC name: 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: VZFUZYWLZUMUFX-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO3 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 4-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | VZFUZYWLZUMUFX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=C(C=C2)OC)C=CN3 |
Computed by PubChem (NCBI)