Products 1506611-77-3

CAS 1506611-77-3 is the registry number for Favipiravir Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-amino-5-bromopyrazine-2-carboxylate (CAS 1506611-77-3) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: methyl 3-amino-5-bromopyrazine-2-carboxylate. InChIKey: UOIGEEVYCPCIJV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6BrN3O2
Molecular weight232.03 g/mol
IUPAC namemethyl 3-amino-5-bromopyrazine-2-carboxylate
InChIKeyUOIGEEVYCPCIJV-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC=C(N=C1N)Br

Computed by PubChem (NCBI)