CAS 150683-27-5 appears in our catalog under these names: Tolvaptan Impurity 1, Tolvaptan Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide (CAS 150683-27-5) is a chemical compound with the molecular formula C25H23ClN2O3 and a molecular weight of 434.9 g/mol. IUPAC name: N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide. InChIKey: CJXNPZYKFICIJP-UHFFFAOYSA-N.
| Molecular formula | C25H23ClN2O3 |
|---|---|
| Molecular weight | 434.9 g/mol |
| IUPAC name | N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide |
| InChIKey | CJXNPZYKFICIJP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)N3CCCC(C4=C3C=CC(=C4)Cl)O |
Computed by PubChem (NCBI)