CAS 1580889-33-3 is the registry number for Tolvaptan Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-3-methylphenyl]benzamide (CAS 1580889-33-3) is a chemical compound with the molecular formula C25H23ClN2O3 and a molecular weight of 434.9 g/mol. IUPAC name: N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-3-methylphenyl]benzamide. InChIKey: LUMJRUXPFNZXRB-UHFFFAOYSA-N.
| Molecular formula | C25H23ClN2O3 |
|---|---|
| Molecular weight | 434.9 g/mol |
| IUPAC name | N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-3-methylphenyl]benzamide |
| InChIKey | LUMJRUXPFNZXRB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=CC=CC=C2)C(=O)N3CCCC(C4=C3C=CC(=C4)Cl)O |
Computed by PubChem (NCBI)