Products 1506878-13-2
CAS 1506878-13-2 appears in our catalog under these names: 1-(4-Bromo-2,6-dimethylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 98%, 1-(4-Bromo-2,6-dimethylphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2,6-dimethylphenyl)-1,3-diazinane-2,4-dione (CAS 1506878-13-2) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: 1-(4-bromo-2,6-dimethylphenyl)-1,3-diazinane-2,4-dione. InChIKey: YHLUSZQGWYBNPG-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | 1-(4-bromo-2,6-dimethylphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | YHLUSZQGWYBNPG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N2CCC(=O)NC2=O)C)Br |
Computed by PubChem (NCBI)