CAS 1423037-29-9 is the registry number for Methyl 7-bromo-1-ethyl-2-methyl-1,3-benzodiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 7-bromo-1-ethyl-2-methylbenzimidazole-5-carboxylate (CAS 1423037-29-9) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: methyl 7-bromo-1-ethyl-2-methylbenzimidazole-5-carboxylate. InChIKey: RMRHESPOOYBRBD-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | methyl 7-bromo-1-ethyl-2-methylbenzimidazole-5-carboxylate |
| InChIKey | RMRHESPOOYBRBD-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=C1C(=CC(=C2)C(=O)OC)Br)C |
Computed by PubChem (NCBI)