CAS 92926-60-8 appears in our catalog under these names: 6-Bromospiro[benzo[d][1,3]oxazine-4,4'-piperidin]-2(1h)-one, 95%, 6–Bromospiro(benzo(d)(1,3)oxazine–4,4'–piperidin)–2(1H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg.
6-bromospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one (CAS 92926-60-8) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: 6-bromospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one. InChIKey: LGBKBIZUZZZSIB-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | 6-bromospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| InChIKey | LGBKBIZUZZZSIB-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)Br)NC(=O)O2 |
Computed by PubChem (NCBI)