CAS 1508037-30-6 appears in our catalog under these names: 4-Bromo-2-(2,2,2-trifluoroethoxy)-1,3-thiazole, 95%, 4-Bromo-2-(2,2,2-trifluoroethoxy)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-2-(2,2,2-trifluoroethoxy)-1,3-thiazole (CAS 1508037-30-6) is a chemical compound with the molecular formula C5H3BrF3NOS and a molecular weight of 262.05 g/mol. IUPAC name: 4-bromo-2-(2,2,2-trifluoroethoxy)-1,3-thiazole. InChIKey: IVZARVONFQIONR-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3NOS |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 4-bromo-2-(2,2,2-trifluoroethoxy)-1,3-thiazole |
| InChIKey | IVZARVONFQIONR-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)