CAS 1628451-88-6 is the registry number for (5-Bromo-3-(trifluoromethyl)isothiazol-4-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-bromo-3-(trifluoromethyl)-1,2-thiazol-4-yl]methanol (CAS 1628451-88-6) is a chemical compound with the molecular formula C5H3BrF3NOS and a molecular weight of 262.05 g/mol. IUPAC name: [5-bromo-3-(trifluoromethyl)-1,2-thiazol-4-yl]methanol. InChIKey: HEEXUXVFHMNLQP-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3NOS |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | [5-bromo-3-(trifluoromethyl)-1,2-thiazol-4-yl]methanol |
| InChIKey | HEEXUXVFHMNLQP-UHFFFAOYSA-N |
| SMILES | C(C1=C(SN=C1C(F)(F)F)Br)O |
Computed by PubChem (NCBI)