CAS 1508099-32-8 is the registry number for 2-(3-(Trifluoromethyl)phenyl)-3,4-dihydro-2H-1,4-benzoxazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,4-benzoxazine (CAS 1508099-32-8) is a chemical compound with the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: BYRAZLKGXXGISI-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | BYRAZLKGXXGISI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2N1)C3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)