Products 869631-31-2

CAS 869631-31-2 is the registry number for 2-Acetamino-4'-trifluoromethylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[2-[4-(trifluoromethyl)phenyl]phenyl]acetamide (CAS 869631-31-2) is a chemical compound with the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. IUPAC name: N-[2-[4-(trifluoromethyl)phenyl]phenyl]acetamide. InChIKey: WVIDINQFUFSBNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12F3NO
Molecular weight279.26 g/mol
IUPAC nameN-[2-[4-(trifluoromethyl)phenyl]phenyl]acetamide
InChIKeyWVIDINQFUFSBNJ-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=CC=C1C2=CC=C(C=C2)C(F)(F)F

Computed by PubChem (NCBI)