CAS 1508543-35-8 is the registry number for Azetidin-3-yl (3-fluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Azetidin-3-yl N-(3-fluorophenyl)carbamate (CAS 1508543-35-8) is a chemical compound with the molecular formula C10H11FN2O2 and a molecular weight of 210.20 g/mol. IUPAC name: azetidin-3-yl N-(3-fluorophenyl)carbamate. InChIKey: VFTXBJDAXKJPRL-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O2 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | azetidin-3-yl N-(3-fluorophenyl)carbamate |
| InChIKey | VFTXBJDAXKJPRL-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC(=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)