CAS 778-56-3 is the registry number for 1-(4-Fluoro-2-nitrophenyl)pyrrolidine, 99%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 500g, 5g, 1g.
1-(4-fluoro-2-nitrophenyl)pyrrolidine (CAS 778-56-3) is a chemical compound with the molecular formula C10H11FN2O2 and a molecular weight of 210.20 g/mol. IUPAC name: 1-(4-fluoro-2-nitrophenyl)pyrrolidine. InChIKey: PSUGFUCCTASXGW-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O2 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 1-(4-fluoro-2-nitrophenyl)pyrrolidine |
| InChIKey | PSUGFUCCTASXGW-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)