Products 1508628-83-8
CAS 1508628-83-8 is the registry number for 4-Chloro-6-(dimethylamino)-2-methylpyrimidine-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-6-(dimethylamino)-2-methylpyrimidine-5-carbaldehyde (CAS 1508628-83-8) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 4-chloro-6-(dimethylamino)-2-methylpyrimidine-5-carbaldehyde. InChIKey: GJNOTJORKQIBQS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 4-chloro-6-(dimethylamino)-2-methylpyrimidine-5-carbaldehyde |
| InChIKey | GJNOTJORKQIBQS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C(=N1)Cl)C=O)N(C)C |
Computed by PubChem (NCBI)