CAS 1509486-15-0 is the registry number for 2-Benzoyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-benzoyl-1,3-thiazole-4-carboxylic acid (CAS 1509486-15-0) is a chemical compound with the molecular formula C11H7NO3S and a molecular weight of 233.24 g/mol. IUPAC name: 2-benzoyl-1,3-thiazole-4-carboxylic acid. InChIKey: VSEMROMIKAJVFV-UHFFFAOYSA-N.
| Molecular formula | C11H7NO3S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 2-benzoyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | VSEMROMIKAJVFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)