Products 1509486-15-0

CAS 1509486-15-0 is the registry number for 2-Benzoyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-benzoyl-1,3-thiazole-4-carboxylic acid (CAS 1509486-15-0) is a chemical compound with the molecular formula C11H7NO3S and a molecular weight of 233.24 g/mol. IUPAC name: 2-benzoyl-1,3-thiazole-4-carboxylic acid. InChIKey: VSEMROMIKAJVFV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7NO3S
Molecular weight233.24 g/mol
IUPAC name2-benzoyl-1,3-thiazole-4-carboxylic acid
InChIKeyVSEMROMIKAJVFV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)