CAS 38401-74-0 is the registry number for 5-(4-Nitrophenyl)thiophene-2-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(4-nitrophenyl)thiophene-2-carbaldehyde (CAS 38401-74-0) is a chemical compound with the molecular formula C11H7NO3S and a molecular weight of 233.24 g/mol. IUPAC name: 5-(4-nitrophenyl)thiophene-2-carbaldehyde. InChIKey: JTCFVBWDULLQMJ-UHFFFAOYSA-N.
| Molecular formula | C11H7NO3S |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 5-(4-nitrophenyl)thiophene-2-carbaldehyde |
| InChIKey | JTCFVBWDULLQMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)