Products 1509828-71-0

CAS 1509828-71-0 is the registry number for 2-(5-(4-Fluorophenyl)-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid (CAS 1509828-71-0) is a chemical compound with the molecular formula C15H9FN2O3 and a molecular weight of 284.24 g/mol. IUPAC name: 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid. InChIKey: MPXOLYQCLQRHKT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9FN2O3
Molecular weight284.24 g/mol
IUPAC name2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid
InChIKeyMPXOLYQCLQRHKT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NN=C(O2)C3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)