CAS 1509828-71-0 is the registry number for 2-(5-(4-Fluorophenyl)-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid (CAS 1509828-71-0) is a chemical compound with the molecular formula C15H9FN2O3 and a molecular weight of 284.24 g/mol. IUPAC name: 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid. InChIKey: MPXOLYQCLQRHKT-UHFFFAOYSA-N.
| Molecular formula | C15H9FN2O3 |
|---|---|
| Molecular weight | 284.24 g/mol |
| IUPAC name | 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| InChIKey | MPXOLYQCLQRHKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)