CAS 69785-85-9 is the registry number for WAY-324709, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
2-(1,3-benzodioxol-5-yl)-5-(2-fluorophenyl)-1,3,4-oxadiazole (CAS 69785-85-9) is a chemical compound with the molecular formula C15H9FN2O3 and a molecular weight of 284.24 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-5-(2-fluorophenyl)-1,3,4-oxadiazole. InChIKey: TZWURTRBMSOAKH-UHFFFAOYSA-N.
| Molecular formula | C15H9FN2O3 |
|---|---|
| Molecular weight | 284.24 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-5-(2-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | TZWURTRBMSOAKH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NN=C(O3)C4=CC=CC=C4F |
Computed by PubChem (NCBI)