CAS 1509941-93-8 appears in our catalog under these names: Cetirizine Polyethylene Glycol Ester (Mixture of Isomers), Cetirizine Impurity 66(Cetirizine Polyethylene Glycol Ester), Cetirizine Polyethylene Glycol (PEG) Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
2-hydroxyethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate (CAS 1509941-93-8) is a chemical compound with the molecular formula C23H29ClN2O4 and a molecular weight of 432.9 g/mol. IUPAC name: 2-hydroxyethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate. InChIKey: FSIOECPQMZXWHY-UHFFFAOYSA-N.
| Molecular formula | C23H29ClN2O4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | 2-hydroxyethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
| InChIKey | FSIOECPQMZXWHY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)OCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)