Products 682323-77-9
CAS 682323-77-9 appears in our catalog under these names: Cetirizine EP Impurity E, Levocetirizine Hydrochloride Impurity E, Cetirizine Impurity 13（Cetirizine EP Impurity E）, Hydroxyzine acetic acid, Cetirizine impurity 7, 98.0%. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]acetic acid (CAS 682323-77-9) is a chemical compound with the molecular formula C23H29ClN2O4 and a molecular weight of 432.9 g/mol. IUPAC name: 2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]acetic acid. InChIKey: AIOFDOGAYXDHHG-UHFFFAOYSA-N.
| Molecular formula | C23H29ClN2O4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | 2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]acetic acid |
| InChIKey | AIOFDOGAYXDHHG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)