CAS 1509963-29-4 is the registry number for N,N-Bis(1-methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g.
N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1509963-29-4) is a chemical compound with the molecular formula C19H30BNO3 and a molecular weight of 331.3 g/mol. IUPAC name: N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: LEQZJJJMBXYGHZ-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO3 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | LEQZJJJMBXYGHZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N(C(C)C)C(C)C |
Computed by PubChem (NCBI)