CAS 2828443-94-1 is the registry number for N,N-Dipropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97+%. Offered by: Ambeed. Available pack sizes: 1g, 250mg, 5g.
N,N-dipropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2828443-94-1) is a chemical compound with the molecular formula C19H30BNO3 and a molecular weight of 331.3 g/mol. IUPAC name: N,N-dipropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: AVPASLJRWBXKHX-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO3 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | N,N-dipropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | AVPASLJRWBXKHX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N(CCC)CCC |
Computed by PubChem (NCBI)