Products 1510570-77-0

CAS 1510570-77-0 is the registry number for 2-[(propan-2-yl)amino]-1,3-thiazole-5-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(propan-2-ylamino)-1,3-thiazole-5-carboxylic acid (CAS 1510570-77-0) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: 2-(propan-2-ylamino)-1,3-thiazole-5-carboxylic acid. InChIKey: OQHOHMYXFNOMLN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O2S
Molecular weight186.23 g/mol
IUPAC name2-(propan-2-ylamino)-1,3-thiazole-5-carboxylic acid
InChIKeyOQHOHMYXFNOMLN-UHFFFAOYSA-N
SMILESCC(C)NC1=NC=C(S1)C(=O)O

Computed by PubChem (NCBI)