CAS 151073-59-5 is the registry number for methyl 3-(4-bromophenyl)-2-acetamidopropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-acetamido-3-(4-bromophenyl)propanoate (CAS 151073-59-5) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: methyl 2-acetamido-3-(4-bromophenyl)propanoate. InChIKey: DJGNZNWTUQNDRV-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | methyl 2-acetamido-3-(4-bromophenyl)propanoate |
| InChIKey | DJGNZNWTUQNDRV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)